C12H16F2N2O — CID 113426493
N-(1-aminopropan-2-yl)-2,6-difluoro-N,3-dimethylbenzamide (PubChem CID 113426493) has the molecular formula C12H16F2N2O and a molecular weight of 242.27 g/mol. Its IUPAC name is N-(1-aminopropan-2-yl)-2,6-difluoro-N,3-dimethylbenzamide.
| Compound Name | N-(1-aminopropan-2-yl)-2,6-difluoro-N,3-dimethylbenzamide |
|---|---|
| PubChem CID | 113426493 |
| Molecular Formula | C12H16F2N2O |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | N-(1-aminopropan-2-yl)-2,6-difluoro-N,3-dimethylbenzamide |
| SMILES | Cc1ccc(F)c(C(=O)N(C)C(C)CN)c1F |
| InChI | InChI=1S/C12H16F2N2O/c1-7-4-5-9(13)10(11(7)14)12(17)16(3)8(2)6-15/h4-5,8H,6,15H2,1-3H3 |
| InChIKey | UUEYNZWTFIDDIT-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |