C10H11BrN4OS — CID 113285899
N-[2-(4-aminopyrazol-1-yl)ethyl]-5-bromothiophene-2-carboxamide (PubChem CID 113285899) has the molecular formula C10H11BrN4OS and a molecular weight of 315.20 g/mol. Its IUPAC name is N-[2-(4-aminopyrazol-1-yl)ethyl]-5-bromothiophene-2-carboxamide.
| Compound Name | N-[2-(4-aminopyrazol-1-yl)ethyl]-5-bromothiophene-2-carboxamide |
|---|---|
| PubChem CID | 113285899 |
| Molecular Formula | C10H11BrN4OS |
| Molecular Weight | 315.20 g/mol |
| Exact Mass | 313.98 |
| IUPAC Name | N-[2-(4-aminopyrazol-1-yl)ethyl]-5-bromothiophene-2-carboxamide |
| SMILES | Nc1cnn(CCNC(=O)c2ccc(Br)s2)c1 |
| InChI | InChI=1S/C10H11BrN4OS/c11-9-2-1-8(17-9)10(16)13-3-4-15-6-7(12)5-14-15/h1-2,5-6H,3-4,12H2,(H,13,16) |
| InChIKey | RBGBXTZKUDCVLM-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.20 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |