C13H12BrClN2OS — CID 113286157
3-bromo-5-chloro-N-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]benzamide (PubChem CID 113286157) has the molecular formula C13H12BrClN2OS and a molecular weight of 359.68 g/mol. Its IUPAC name is 3-bromo-5-chloro-N-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]benzamide.
| Compound Name | 3-bromo-5-chloro-N-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 113286157 |
| Molecular Formula | C13H12BrClN2OS |
| Molecular Weight | 359.68 g/mol |
| Exact Mass | 357.95 |
| IUPAC Name | 3-bromo-5-chloro-N-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]benzamide |
| SMILES | Cc1csc(CCNC(=O)c2cc(Cl)cc(Br)c2)n1 |
| InChI | InChI=1S/C13H12BrClN2OS/c1-8-7-19-12(17-8)2-3-16-13(18)9-4-10(14)6-11(15)5-9/h4-7H,2-3H2,1H3,(H,16,18) |
| InChIKey | FDOADELGPYNWGC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.68 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |