C11H16N4O3 — CID 113286359
1-(6-methoxy-3-nitro-2-pyridinyl)-1,4-diazepane (PubChem CID 113286359) has the molecular formula C11H16N4O3 and a molecular weight of 252.27 g/mol. Its IUPAC name is 1-(6-methoxy-3-nitro-2-pyridinyl)-1,4-diazepane.
| Compound Name | 1-(6-methoxy-3-nitro-2-pyridinyl)-1,4-diazepane |
|---|---|
| PubChem CID | 113286359 |
| Molecular Formula | C11H16N4O3 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 1-(6-methoxy-3-nitro-2-pyridinyl)-1,4-diazepane |
| SMILES | COc1ccc([N+](=O)[O-])c(N2CCCNCC2)n1 |
| InChI | InChI=1S/C11H16N4O3/c1-18-10-4-3-9(15(16)17)11(13-10)14-7-2-5-12-6-8-14/h3-4,12H,2,5-8H2,1H3 |
| InChIKey | XCYUSQLLXIJYFN-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 80.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|