C9H8BrN3O3S — CID 113288340
3-amino-4-bromo-N-(1,2-oxazol-3-yl)benzenesulfonamide (PubChem CID 113288340) has the molecular formula C9H8BrN3O3S and a molecular weight of 318.15 g/mol. Its IUPAC name is 3-amino-4-bromo-N-(1,2-oxazol-3-yl)benzenesulfonamide.
| Compound Name | 3-amino-4-bromo-N-(1,2-oxazol-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 113288340 |
| Molecular Formula | C9H8BrN3O3S |
| Molecular Weight | 318.15 g/mol |
| Exact Mass | 316.95 |
| IUPAC Name | 3-amino-4-bromo-N-(1,2-oxazol-3-yl)benzenesulfonamide |
| SMILES | Nc1cc(S(=O)(=O)Nc2ccon2)ccc1Br |
| InChI | InChI=1S/C9H8BrN3O3S/c10-7-2-1-6(5-8(7)11)17(14,15)13-9-3-4-16-12-9/h1-5H,11H2,(H,12,13) |
| InChIKey | QFKHPVKNHIAYHI-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.15 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|