C12H15N3O3S — CID 62904312
N-(1,2-oxazol-3-yl)-4-(propylamino)benzenesulfonamide (PubChem CID 62904312) has the molecular formula C12H15N3O3S and a molecular weight of 281.34 g/mol. Its IUPAC name is N-(1,2-oxazol-3-yl)-4-(propylamino)benzenesulfonamide.
| Compound Name | N-(1,2-oxazol-3-yl)-4-(propylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 62904312 |
| Molecular Formula | C12H15N3O3S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | N-(1,2-oxazol-3-yl)-4-(propylamino)benzenesulfonamide |
| SMILES | CCCNc1ccc(S(=O)(=O)Nc2ccon2)cc1 |
| InChI | InChI=1S/C12H15N3O3S/c1-2-8-13-10-3-5-11(6-4-10)19(16,17)15-12-7-9-18-14-12/h3-7,9,13H,2,8H2,1H3,(H,14,15) |
| InChIKey | VRXKFMGUFUKUIU-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |