C9H11N5O3S — CID 62902362
2-(ethylamino)-N-(1,2-oxazol-3-yl)pyrimidine-5-sulfonamide (PubChem CID 62902362) has the molecular formula C9H11N5O3S and a molecular weight of 269.29 g/mol. Its IUPAC name is 2-(ethylamino)-N-(1,2-oxazol-3-yl)pyrimidine-5-sulfonamide.
| Compound Name | 2-(ethylamino)-N-(1,2-oxazol-3-yl)pyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 62902362 |
| Molecular Formula | C9H11N5O3S |
| Molecular Weight | 269.29 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | 2-(ethylamino)-N-(1,2-oxazol-3-yl)pyrimidine-5-sulfonamide |
| SMILES | CCNc1ncc(S(=O)(=O)Nc2ccon2)cn1 |
| InChI | InChI=1S/C9H11N5O3S/c1-2-10-9-11-5-7(6-12-9)18(15,16)14-8-3-4-17-13-8/h3-6H,2H2,1H3,(H,13,14)(H,10,11,12) |
| InChIKey | AOSZJASGYFGIHB-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.29 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |