C13H14N2O4S — CID 84599289
4-(2-methylpropanoyl)-N-(1,2-oxazol-3-yl)benzenesulfonamide (PubChem CID 84599289) has the molecular formula C13H14N2O4S and a molecular weight of 294.33 g/mol. Its IUPAC name is 4-(2-methylpropanoyl)-N-(1,2-oxazol-3-yl)benzenesulfonamide.
| Compound Name | 4-(2-methylpropanoyl)-N-(1,2-oxazol-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 84599289 |
| Molecular Formula | C13H14N2O4S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 4-(2-methylpropanoyl)-N-(1,2-oxazol-3-yl)benzenesulfonamide |
| SMILES | CC(C)C(=O)c1ccc(S(=O)(=O)Nc2ccon2)cc1 |
| InChI | InChI=1S/C13H14N2O4S/c1-9(2)13(16)10-3-5-11(6-4-10)20(17,18)15-12-7-8-19-14-12/h3-9H,1-2H3,(H,14,15) |
| InChIKey | MOWQWQWTOZRKBM-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |