C25H24N6S2 — CID 11328938
N-[1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,3-dihydroindol-5-yl]-6-[2-[(2R)-pyrrolidin-2-yl]ethynyl]thieno[3,2-d]pyrimidin-4-amine (PubChem CID 11328938) has the molecular formula C25H24N6S2 and a molecular weight of 472.64 g/mol. Its IUPAC name is N-[1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,3-dihydroindol-5-yl]-6-[2-[(2R)-pyrrolidin-2-yl]ethynyl]thieno[3,2-d]pyrimidin-4-amine.
| Compound Name | N-[1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,3-dihydroindol-5-yl]-6-[2-[(2R)-pyrrolidin-2-yl]ethynyl]thieno[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 11328938 |
| Molecular Formula | C25H24N6S2 |
| Molecular Weight | 472.64 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | N-[1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,3-dihydroindol-5-yl]-6-[2-[(2R)-pyrrolidin-2-yl]ethynyl]thieno[3,2-d]pyrimidin-4-amine |
| SMILES | Cc1nc(CN2CCc3cc(Nc4ncnc5cc(C#C[C@H]6CCCN6)sc45)ccc32)cs1 |
| InChI | InChI=1S/C25H24N6S2/c1-16-29-20(14-32-16)13-31-10-8-17-11-19(5-7-23(17)31)30-25-24-22(27-15-28-25)12-21(33-24)6-4-18-3-2-9-26-18/h5,7,11-12,14-15,18,26H,2-3,8-10,13H2,1H3,(H,27,28,30)/t18-/m1/s1 |
| InChIKey | UFUUZZRLAFATSY-GOSISDBHSA-N |
| XLogP | 4.87 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.64 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|