C24H19N5O2S3 — CID 11409542
6-[2-[(2R)-pyrrolidin-2-yl]ethynyl]-N-(1-thiophen-2-ylsulfonylindol-5-yl)thieno[3,2-d]pyrimidin-4-amine (PubChem CID 11409542) has the molecular formula C24H19N5O2S3 and a molecular weight of 505.65 g/mol. Its IUPAC name is 6-[2-[(2R)-pyrrolidin-2-yl]ethynyl]-N-(1-thiophen-2-ylsulfonylindol-5-yl)thieno[3,2-d]pyrimidin-4-amine.
| Compound Name | 6-[2-[(2R)-pyrrolidin-2-yl]ethynyl]-N-(1-thiophen-2-ylsulfonylindol-5-yl)thieno[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 11409542 |
| Molecular Formula | C24H19N5O2S3 |
| Molecular Weight | 505.65 g/mol |
| Exact Mass | 505.07 |
| IUPAC Name | 6-[2-[(2R)-pyrrolidin-2-yl]ethynyl]-N-(1-thiophen-2-ylsulfonylindol-5-yl)thieno[3,2-d]pyrimidin-4-amine |
| SMILES | O=S(=O)(c1cccs1)n1ccc2cc(Nc3ncnc4cc(C#C[C@H]5CCCN5)sc34)ccc21 |
| InChI | InChI=1S/C24H19N5O2S3/c30-34(31,22-4-2-12-32-22)29-11-9-16-13-18(6-8-21(16)29)28-24-23-20(26-15-27-24)14-19(33-23)7-5-17-3-1-10-25-17/h2,4,6,8-9,11-15,17,25H,1,3,10H2,(H,26,27,28)/t17-/m1/s1 |
| InChIKey | WYXFGUKKBDPVJK-QGZVFWFLSA-N |
| XLogP | 4.79 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.65 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|