C24H19Cl2N5OS — CID 44527958
N-[3-chloro-4-[(2-chloro-3-pyridinyl)methoxy]phenyl]-6-[2-[(2R)-pyrrolidin-2-yl]ethynyl]thieno[2,3-d]pyrimidin-4-amine (PubChem CID 44527958) has the molecular formula C24H19Cl2N5OS and a molecular weight of 496.42 g/mol. Its IUPAC name is N-[3-chloro-4-[(2-chloro-3-pyridinyl)methoxy]phenyl]-6-[2-[(2R)-pyrrolidin-2-yl]ethynyl]thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[3-chloro-4-[(2-chloro-3-pyridinyl)methoxy]phenyl]-6-[2-[(2R)-pyrrolidin-2-yl]ethynyl]thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 44527958 |
| Molecular Formula | C24H19Cl2N5OS |
| Molecular Weight | 496.42 g/mol |
| Exact Mass | 495.07 |
| IUPAC Name | N-[3-chloro-4-[(2-chloro-3-pyridinyl)methoxy]phenyl]-6-[2-[(2R)-pyrrolidin-2-yl]ethynyl]thieno[2,3-d]pyrimidin-4-amine |
| SMILES | Clc1cc(Nc2ncnc3sc(C#C[C@H]4CCCN4)cc23)ccc1OCc1cccnc1Cl |
| InChI | InChI=1S/C24H19Cl2N5OS/c25-20-11-17(6-8-21(20)32-13-15-3-1-10-28-22(15)26)31-23-19-12-18(33-24(19)30-14-29-23)7-5-16-4-2-9-27-16/h1,3,6,8,10-12,14,16,27H,2,4,9,13H2,(H,29,30,31)/t16-/m1/s1 |
| InChIKey | MZTUKYNMJJZOCK-MRXNPFEDSA-N |
| XLogP | 5.82 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.42 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|