C18H15ClN4S — CID 11268260
N-(3-chlorophenyl)-6-[2-[(2S)-pyrrolidin-2-yl]ethynyl]thieno[3,2-d]pyrimidin-4-amine (PubChem CID 11268260) has the molecular formula C18H15ClN4S and a molecular weight of 354.87 g/mol. Its IUPAC name is N-(3-chlorophenyl)-6-[2-[(2S)-pyrrolidin-2-yl]ethynyl]thieno[3,2-d]pyrimidin-4-amine.
| Compound Name | N-(3-chlorophenyl)-6-[2-[(2S)-pyrrolidin-2-yl]ethynyl]thieno[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 11268260 |
| Molecular Formula | C18H15ClN4S |
| Molecular Weight | 354.87 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | N-(3-chlorophenyl)-6-[2-[(2S)-pyrrolidin-2-yl]ethynyl]thieno[3,2-d]pyrimidin-4-amine |
| SMILES | Clc1cccc(Nc2ncnc3cc(C#C[C@@H]4CCCN4)sc23)c1 |
| InChI | InChI=1S/C18H15ClN4S/c19-12-3-1-4-14(9-12)23-18-17-16(21-11-22-18)10-15(24-17)7-6-13-5-2-8-20-13/h1,3-4,9-11,13,20H,2,5,8H2,(H,21,22,23)/t13-/m0/s1 |
| InChIKey | MBVHGLVHWCKQSX-ZDUSSCGKSA-N |
| XLogP | 4.19 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.87 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|