C24H15Cl2N5OS — CID 11363875
N-[3-chloro-4-[(3-chlorophenyl)methoxy]phenyl]-6-[2-(1H-pyrazol-4-yl)ethynyl]thieno[3,2-d]pyrimidin-4-amine (PubChem CID 11363875) has the molecular formula C24H15Cl2N5OS and a molecular weight of 492.39 g/mol. Its IUPAC name is N-[3-chloro-4-[(3-chlorophenyl)methoxy]phenyl]-6-[2-(1H-pyrazol-4-yl)ethynyl]thieno[3,2-d]pyrimidin-4-amine.
| Compound Name | N-[3-chloro-4-[(3-chlorophenyl)methoxy]phenyl]-6-[2-(1H-pyrazol-4-yl)ethynyl]thieno[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 11363875 |
| Molecular Formula | C24H15Cl2N5OS |
| Molecular Weight | 492.39 g/mol |
| Exact Mass | 491.04 |
| IUPAC Name | N-[3-chloro-4-[(3-chlorophenyl)methoxy]phenyl]-6-[2-(1H-pyrazol-4-yl)ethynyl]thieno[3,2-d]pyrimidin-4-amine |
| SMILES | Clc1cccc(COc2ccc(Nc3ncnc4cc(C#Cc5cn[nH]c5)sc34)cc2Cl)c1 |
| InChI | InChI=1S/C24H15Cl2N5OS/c25-17-3-1-2-15(8-17)13-32-22-7-5-18(9-20(22)26)31-24-23-21(27-14-28-24)10-19(33-23)6-4-16-11-29-30-12-16/h1-3,5,7-12,14H,13H2,(H,29,30)(H,27,28,31) |
| InChIKey | JLBHYPNLULKXEG-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.39 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|