C26H18N4O2S2 — CID 11102921
N-[1-(benzenesulfonyl)indol-5-yl]-6-phenylthieno[3,2-d]pyrimidin-4-amine (PubChem CID 11102921) has the molecular formula C26H18N4O2S2 and a molecular weight of 482.59 g/mol. Its IUPAC name is N-[1-(benzenesulfonyl)indol-5-yl]-6-phenylthieno[3,2-d]pyrimidin-4-amine.
| Compound Name | N-[1-(benzenesulfonyl)indol-5-yl]-6-phenylthieno[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 11102921 |
| Molecular Formula | C26H18N4O2S2 |
| Molecular Weight | 482.59 g/mol |
| Exact Mass | 482.09 |
| IUPAC Name | N-[1-(benzenesulfonyl)indol-5-yl]-6-phenylthieno[3,2-d]pyrimidin-4-amine |
| SMILES | O=S(=O)(c1ccccc1)n1ccc2cc(Nc3ncnc4cc(-c5ccccc5)sc34)ccc21 |
| InChI | InChI=1S/C26H18N4O2S2/c31-34(32,21-9-5-2-6-10-21)30-14-13-19-15-20(11-12-23(19)30)29-26-25-22(27-17-28-26)16-24(33-25)18-7-3-1-4-8-18/h1-17H,(H,27,28,29) |
| InChIKey | YKJYSYWXBZWFJT-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.59 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |