C22H17ClN4O2S — CID 10503106
3-chloro-4-(4-methoxyphenyl)-1-[(6-phenylthieno[3,2-d]pyrimidin-4-yl)amino]azetidin-2-one (PubChem CID 10503106) has the molecular formula C22H17ClN4O2S and a molecular weight of 436.92 g/mol. Its IUPAC name is 3-chloro-4-(4-methoxyphenyl)-1-[(6-phenylthieno[3,2-d]pyrimidin-4-yl)amino]azetidin-2-one.
| Compound Name | 3-chloro-4-(4-methoxyphenyl)-1-[(6-phenylthieno[3,2-d]pyrimidin-4-yl)amino]azetidin-2-one |
|---|---|
| PubChem CID | 10503106 |
| Molecular Formula | C22H17ClN4O2S |
| Molecular Weight | 436.92 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | 3-chloro-4-(4-methoxyphenyl)-1-[(6-phenylthieno[3,2-d]pyrimidin-4-yl)amino]azetidin-2-one |
| SMILES | COc1ccc(C2C(Cl)C(=O)N2Nc2ncnc3cc(-c4ccccc4)sc23)cc1 |
| InChI | InChI=1S/C22H17ClN4O2S/c1-29-15-9-7-14(8-10-15)19-18(23)22(28)27(19)26-21-20-16(24-12-25-21)11-17(30-20)13-5-3-2-4-6-13/h2-12,18-19H,1H3,(H,24,25,26) |
| InChIKey | GLXBUMWDIMNXLP-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.92 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|