C21H19N5O2S2 — CID 58768475
1-(2,5-dimethoxyphenyl)-3-[(6-phenylthieno[3,2-d]pyrimidin-4-yl)amino]thiourea (PubChem CID 58768475) has the molecular formula C21H19N5O2S2 and a molecular weight of 437.55 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-3-[(6-phenylthieno[3,2-d]pyrimidin-4-yl)amino]thiourea.
| Compound Name | 1-(2,5-dimethoxyphenyl)-3-[(6-phenylthieno[3,2-d]pyrimidin-4-yl)amino]thiourea |
|---|---|
| PubChem CID | 58768475 |
| Molecular Formula | C21H19N5O2S2 |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-3-[(6-phenylthieno[3,2-d]pyrimidin-4-yl)amino]thiourea |
| SMILES | COc1ccc(OC)c(NC(=S)NNc2ncnc3cc(-c4ccccc4)sc23)c1 |
| InChI | InChI=1S/C21H19N5O2S2/c1-27-14-8-9-17(28-2)15(10-14)24-21(29)26-25-20-19-16(22-12-23-20)11-18(30-19)13-6-4-3-5-7-13/h3-12H,1-2H3,(H,22,23,25)(H2,24,26,29) |
| InChIKey | XQZDFLDLWBQFNJ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 80.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|