C12H13IO4S — CID 113289960
3-[(4-iodophenyl)methyl]-1,1-dioxothiolane-3-carboxylic acid (PubChem CID 113289960) has the molecular formula C12H13IO4S and a molecular weight of 380.20 g/mol. Its IUPAC name is 3-[(4-iodophenyl)methyl]-1,1-dioxothiolane-3-carboxylic acid.
| Compound Name | 3-[(4-iodophenyl)methyl]-1,1-dioxothiolane-3-carboxylic acid |
|---|---|
| PubChem CID | 113289960 |
| Molecular Formula | C12H13IO4S |
| Molecular Weight | 380.20 g/mol |
| Exact Mass | 379.96 |
| IUPAC Name | 3-[(4-iodophenyl)methyl]-1,1-dioxothiolane-3-carboxylic acid |
| SMILES | O=C(O)C1(Cc2ccc(I)cc2)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H13IO4S/c13-10-3-1-9(2-4-10)7-12(11(14)15)5-6-18(16,17)8-12/h1-4H,5-8H2,(H,14,15) |
| InChIKey | WQRVMZIHGNACAP-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.20 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|