C15H25IN2 — CID 113291375
4-(4-iodophenyl)-1-N,1-N-dimethyl-3-N-propylbutane-1,3-diamine (PubChem CID 113291375) has the molecular formula C15H25IN2 and a molecular weight of 360.28 g/mol. Its IUPAC name is 4-(4-iodophenyl)-1-N,1-N-dimethyl-3-N-propylbutane-1,3-diamine.
| Compound Name | 4-(4-iodophenyl)-1-N,1-N-dimethyl-3-N-propylbutane-1,3-diamine |
|---|---|
| PubChem CID | 113291375 |
| Molecular Formula | C15H25IN2 |
| Molecular Weight | 360.28 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 4-(4-iodophenyl)-1-N,1-N-dimethyl-3-N-propylbutane-1,3-diamine |
| SMILES | CCCNC(CCN(C)C)Cc1ccc(I)cc1 |
| InChI | InChI=1S/C15H25IN2/c1-4-10-17-15(9-11-18(2)3)12-13-5-7-14(16)8-6-13/h5-8,15,17H,4,9-12H2,1-3H3 |
| InChIKey | MXUYUXWFIYFHBX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.28 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|