C16H26INS — CID 65478586
1-(4-iodophenyl)-3-(2-methylpropylsulfanyl)-N-propylpropan-2-amine (PubChem CID 65478586) has the molecular formula C16H26INS and a molecular weight of 391.36 g/mol. Its IUPAC name is 1-(4-iodophenyl)-3-(2-methylpropylsulfanyl)-N-propylpropan-2-amine.
| Compound Name | 1-(4-iodophenyl)-3-(2-methylpropylsulfanyl)-N-propylpropan-2-amine |
|---|---|
| PubChem CID | 65478586 |
| Molecular Formula | C16H26INS |
| Molecular Weight | 391.36 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | 1-(4-iodophenyl)-3-(2-methylpropylsulfanyl)-N-propylpropan-2-amine |
| SMILES | CCCNC(CSCC(C)C)Cc1ccc(I)cc1 |
| InChI | InChI=1S/C16H26INS/c1-4-9-18-16(12-19-11-13(2)3)10-14-5-7-15(17)8-6-14/h5-8,13,16,18H,4,9-12H2,1-3H3 |
| InChIKey | UGJYKPMYIQBEJQ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.36 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|