C12H13Cl3N2S — CID 113294118
5,5-dimethyl-N-(2,4,5-trichlorophenyl)-4,6-dihydro-1,3-thiazin-2-amine (PubChem CID 113294118) has the molecular formula C12H13Cl3N2S and a molecular weight of 323.68 g/mol. Its IUPAC name is 5,5-dimethyl-N-(2,4,5-trichlorophenyl)-4,6-dihydro-1,3-thiazin-2-amine.
| Compound Name | 5,5-dimethyl-N-(2,4,5-trichlorophenyl)-4,6-dihydro-1,3-thiazin-2-amine |
|---|---|
| PubChem CID | 113294118 |
| Molecular Formula | C12H13Cl3N2S |
| Molecular Weight | 323.68 g/mol |
| Exact Mass | 321.99 |
| IUPAC Name | 5,5-dimethyl-N-(2,4,5-trichlorophenyl)-4,6-dihydro-1,3-thiazin-2-amine |
| SMILES | CC1(C)CN=C(Nc2cc(Cl)c(Cl)cc2Cl)SC1 |
| InChI | InChI=1S/C12H13Cl3N2S/c1-12(2)5-16-11(18-6-12)17-10-4-8(14)7(13)3-9(10)15/h3-4H,5-6H2,1-2H3,(H,16,17) |
| InChIKey | QQEGKVBZENLBLM-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.68 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|