C15H17ClN2O — CID 113294924
N-(3-chloro-2,2-dimethylpropyl)isoquinoline-1-carboxamide (PubChem CID 113294924) has the molecular formula C15H17ClN2O and a molecular weight of 276.77 g/mol. Its IUPAC name is N-(3-chloro-2,2-dimethylpropyl)isoquinoline-1-carboxamide.
| Compound Name | N-(3-chloro-2,2-dimethylpropyl)isoquinoline-1-carboxamide |
|---|---|
| PubChem CID | 113294924 |
| Molecular Formula | C15H17ClN2O |
| Molecular Weight | 276.77 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | N-(3-chloro-2,2-dimethylpropyl)isoquinoline-1-carboxamide |
| SMILES | CC(C)(CCl)CNC(=O)c1nccc2ccccc12 |
| InChI | InChI=1S/C15H17ClN2O/c1-15(2,9-16)10-18-14(19)13-12-6-4-3-5-11(12)7-8-17-13/h3-8H,9-10H2,1-2H3,(H,18,19) |
| InChIKey | OBYBEOQVKCMKCK-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.77 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|