C14H21NS2 — CID 113299524
(3-ethylphenyl)-(3-methyl-1,4-dithian-2-yl)methanamine (PubChem CID 113299524) has the molecular formula C14H21NS2 and a molecular weight of 267.46 g/mol. Its IUPAC name is (3-ethylphenyl)-(3-methyl-1,4-dithian-2-yl)methanamine.
| Compound Name | (3-ethylphenyl)-(3-methyl-1,4-dithian-2-yl)methanamine |
|---|---|
| PubChem CID | 113299524 |
| Molecular Formula | C14H21NS2 |
| Molecular Weight | 267.46 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | (3-ethylphenyl)-(3-methyl-1,4-dithian-2-yl)methanamine |
| SMILES | CCc1cccc(C(N)C2SCCSC2C)c1 |
| InChI | InChI=1S/C14H21NS2/c1-3-11-5-4-6-12(9-11)13(15)14-10(2)16-7-8-17-14/h4-6,9-10,13-14H,3,7-8,15H2,1-2H3 |
| InChIKey | CSBATZJMMAUYKU-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.46 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |