C11H16N4O2S — CID 113300306
4-tert-butyl-3-[5-(methoxymethyl)-1,2-oxazol-3-yl]-1H-1,2,4-triazole-5-thione (PubChem CID 113300306) has the molecular formula C11H16N4O2S and a molecular weight of 268.34 g/mol. Its IUPAC name is 4-tert-butyl-3-[5-(methoxymethyl)-1,2-oxazol-3-yl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-tert-butyl-3-[5-(methoxymethyl)-1,2-oxazol-3-yl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 113300306 |
| Molecular Formula | C11H16N4O2S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 4-tert-butyl-3-[5-(methoxymethyl)-1,2-oxazol-3-yl]-1H-1,2,4-triazole-5-thione |
| SMILES | COCc1cc(-c2n[nH]c(=S)n2C(C)(C)C)no1 |
| InChI | InChI=1S/C11H16N4O2S/c1-11(2,3)15-9(12-13-10(15)18)8-5-7(6-16-4)17-14-8/h5H,6H2,1-4H3,(H,13,18) |
| InChIKey | KJQZAMGMBBAESN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|