C12H14ClN3OS — CID 106502410
4-tert-butyl-3-(2-chloro-5-hydroxyphenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 106502410) has the molecular formula C12H14ClN3OS and a molecular weight of 283.78 g/mol. Its IUPAC name is 4-tert-butyl-3-(2-chloro-5-hydroxyphenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-tert-butyl-3-(2-chloro-5-hydroxyphenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 106502410 |
| Molecular Formula | C12H14ClN3OS |
| Molecular Weight | 283.78 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 4-tert-butyl-3-(2-chloro-5-hydroxyphenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | CC(C)(C)n1c(-c2cc(O)ccc2Cl)n[nH]c1=S |
| InChI | InChI=1S/C12H14ClN3OS/c1-12(2,3)16-10(14-15-11(16)18)8-6-7(17)4-5-9(8)13/h4-6,17H,1-3H3,(H,15,18) |
| InChIKey | XPLQYLONONWGPQ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.78 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|