C8H6ClN3OS — CID 106502406
5-(2-chloro-5-hydroxyphenyl)-1,2-dihydro-1,2,4-triazole-3-thione (PubChem CID 106502406) has the molecular formula C8H6ClN3OS and a molecular weight of 227.68 g/mol. Its IUPAC name is 5-(2-chloro-5-hydroxyphenyl)-1,2-dihydro-1,2,4-triazole-3-thione.
| Compound Name | 5-(2-chloro-5-hydroxyphenyl)-1,2-dihydro-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 106502406 |
| Molecular Formula | C8H6ClN3OS |
| Molecular Weight | 227.68 g/mol |
| Exact Mass | 226.99 |
| IUPAC Name | 5-(2-chloro-5-hydroxyphenyl)-1,2-dihydro-1,2,4-triazole-3-thione |
| SMILES | Oc1ccc(Cl)c(-c2nc(=S)[nH][nH]2)c1 |
| InChI | InChI=1S/C8H6ClN3OS/c9-6-2-1-4(13)3-5(6)7-10-8(14)12-11-7/h1-3,13H,(H2,10,11,12,14) |
| InChIKey | KXQOORSIMWYYLE-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 64.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.68 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|