C11H15N3OS — CID 115390517
4-tert-butyl-3-(2-methylfuran-3-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 115390517) has the molecular formula C11H15N3OS and a molecular weight of 237.33 g/mol. Its IUPAC name is 4-tert-butyl-3-(2-methylfuran-3-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-tert-butyl-3-(2-methylfuran-3-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 115390517 |
| Molecular Formula | C11H15N3OS |
| Molecular Weight | 237.33 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 4-tert-butyl-3-(2-methylfuran-3-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1occc1-c1n[nH]c(=S)n1C(C)(C)C |
| InChI | InChI=1S/C11H15N3OS/c1-7-8(5-6-15-7)9-12-13-10(16)14(9)11(2,3)4/h5-6H,1-4H3,(H,13,16) |
| InChIKey | YTOIJFXPUKIBDN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 46.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|