C12H17N3OS — CID 113300272
4-tert-butyl-3-[2-(furan-2-yl)ethyl]-1H-1,2,4-triazole-5-thione (PubChem CID 113300272) has the molecular formula C12H17N3OS and a molecular weight of 251.35 g/mol. Its IUPAC name is 4-tert-butyl-3-[2-(furan-2-yl)ethyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-tert-butyl-3-[2-(furan-2-yl)ethyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 113300272 |
| Molecular Formula | C12H17N3OS |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 4-tert-butyl-3-[2-(furan-2-yl)ethyl]-1H-1,2,4-triazole-5-thione |
| SMILES | CC(C)(C)n1c(CCc2ccco2)n[nH]c1=S |
| InChI | InChI=1S/C12H17N3OS/c1-12(2,3)15-10(13-14-11(15)17)7-6-9-5-4-8-16-9/h4-5,8H,6-7H2,1-3H3,(H,14,17) |
| InChIKey | WSEOOTCITCKCAI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 46.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|