C16H17N3OS2 — CID 73333441
4-benzyl-3-[2-(furan-2-ylmethylsulfanyl)ethyl]-1H-1,2,4-triazole-5-thione (PubChem CID 73333441) has the molecular formula C16H17N3OS2 and a molecular weight of 331.47 g/mol. Its IUPAC name is 4-benzyl-3-[2-(furan-2-ylmethylsulfanyl)ethyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-benzyl-3-[2-(furan-2-ylmethylsulfanyl)ethyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 73333441 |
| Molecular Formula | C16H17N3OS2 |
| Molecular Weight | 331.47 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 4-benzyl-3-[2-(furan-2-ylmethylsulfanyl)ethyl]-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]nc(CCSCc2ccco2)n1Cc1ccccc1 |
| InChI | InChI=1S/C16H17N3OS2/c21-16-18-17-15(8-10-22-12-14-7-4-9-20-14)19(16)11-13-5-2-1-3-6-13/h1-7,9H,8,10-12H2,(H,18,21) |
| InChIKey | MUEWIKAUXXXMEL-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 46.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|