C12H13ClFN3S — CID 113300307
4-tert-butyl-3-(3-chloro-2-fluorophenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 113300307) has the molecular formula C12H13ClFN3S and a molecular weight of 285.78 g/mol. Its IUPAC name is 4-tert-butyl-3-(3-chloro-2-fluorophenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-tert-butyl-3-(3-chloro-2-fluorophenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 113300307 |
| Molecular Formula | C12H13ClFN3S |
| Molecular Weight | 285.78 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | 4-tert-butyl-3-(3-chloro-2-fluorophenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | CC(C)(C)n1c(-c2cccc(Cl)c2F)n[nH]c1=S |
| InChI | InChI=1S/C12H13ClFN3S/c1-12(2,3)17-10(15-16-11(17)18)7-5-4-6-8(13)9(7)14/h4-6H,1-3H3,(H,16,18) |
| InChIKey | VSDJVAZMPXMGCG-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.78 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|