C15H21BrOS — CID 113303065
[1-[(4-bromo-2-propan-2-ylphenoxy)methyl]cyclobutyl]methanethiol (PubChem CID 113303065) has the molecular formula C15H21BrOS and a molecular weight of 329.30 g/mol. Its IUPAC name is [1-[(4-bromo-2-propan-2-ylphenoxy)methyl]cyclobutyl]methanethiol.
| Compound Name | [1-[(4-bromo-2-propan-2-ylphenoxy)methyl]cyclobutyl]methanethiol |
|---|---|
| PubChem CID | 113303065 |
| Molecular Formula | C15H21BrOS |
| Molecular Weight | 329.30 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | [1-[(4-bromo-2-propan-2-ylphenoxy)methyl]cyclobutyl]methanethiol |
| SMILES | CC(C)c1cc(Br)ccc1OCC1(CS)CCC1 |
| InChI | InChI=1S/C15H21BrOS/c1-11(2)13-8-12(16)4-5-14(13)17-9-15(10-18)6-3-7-15/h4-5,8,11,18H,3,6-7,9-10H2,1-2H3 |
| InChIKey | QYCZNEJEUZYTAN-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.30 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|