C18H27BrOS — CID 115403065
[1-[(4-bromo-2-propan-2-ylphenoxy)methyl]cycloheptyl]methanethiol (PubChem CID 115403065) has the molecular formula C18H27BrOS and a molecular weight of 371.38 g/mol. Its IUPAC name is [1-[(4-bromo-2-propan-2-ylphenoxy)methyl]cycloheptyl]methanethiol.
| Compound Name | [1-[(4-bromo-2-propan-2-ylphenoxy)methyl]cycloheptyl]methanethiol |
|---|---|
| PubChem CID | 115403065 |
| Molecular Formula | C18H27BrOS |
| Molecular Weight | 371.38 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | [1-[(4-bromo-2-propan-2-ylphenoxy)methyl]cycloheptyl]methanethiol |
| SMILES | CC(C)c1cc(Br)ccc1OCC1(CS)CCCCCC1 |
| InChI | InChI=1S/C18H27BrOS/c1-14(2)16-11-15(19)7-8-17(16)20-12-18(13-21)9-5-3-4-6-10-18/h7-8,11,14,21H,3-6,9-10,12-13H2,1-2H3 |
| InChIKey | QZBYWKVKXUZNNX-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.38 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|