C15H11BrN2 — CID 113303285
13-bromo-5-methyl-2,8-diazatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),3,5,7,10(15),11,13-heptaene (PubChem CID 113303285) has the molecular formula C15H11BrN2 and a molecular weight of 299.17 g/mol. Its IUPAC name is 13-bromo-5-methyl-2,8-diazatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),3,5,7,10(15),11,13-heptaene.
| Compound Name | 13-bromo-5-methyl-2,8-diazatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),3,5,7,10(15),11,13-heptaene |
|---|---|
| PubChem CID | 113303285 |
| Molecular Formula | C15H11BrN2 |
| Molecular Weight | 299.17 g/mol |
| Exact Mass | 298.01 |
| IUPAC Name | 13-bromo-5-methyl-2,8-diazatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),3,5,7,10(15),11,13-heptaene |
| SMILES | Cc1ccn2c3c(nc2c1)-c1ccc(Br)cc1C3 |
| InChI | InChI=1S/C15H11BrN2/c1-9-4-5-18-13-8-10-7-11(16)2-3-12(10)15(13)17-14(18)6-9/h2-7H,8H2,1H3 |
| InChIKey | AXHMAOYFCCNNFE-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.17 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |