C18H16BrFN2O — CID 177064329
2-(4-bromo-2-fluoro-6-methylphenyl)-7-methyl-3-(oxiran-2-ylmethyl)imidazo[1,2-a]pyridine (PubChem CID 177064329) has the molecular formula C18H16BrFN2O and a molecular weight of 375.24 g/mol. Its IUPAC name is 2-(4-bromo-2-fluoro-6-methylphenyl)-7-methyl-3-(oxiran-2-ylmethyl)imidazo[1,2-a]pyridine.
| Compound Name | 2-(4-bromo-2-fluoro-6-methylphenyl)-7-methyl-3-(oxiran-2-ylmethyl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 177064329 |
| Molecular Formula | C18H16BrFN2O |
| Molecular Weight | 375.24 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | 2-(4-bromo-2-fluoro-6-methylphenyl)-7-methyl-3-(oxiran-2-ylmethyl)imidazo[1,2-a]pyridine |
| SMILES | Cc1ccn2c(CC3CO3)c(-c3c(C)cc(Br)cc3F)nc2c1 |
| InChI | InChI=1S/C18H16BrFN2O/c1-10-3-4-22-15(8-13-9-23-13)18(21-16(22)5-10)17-11(2)6-12(19)7-14(17)20/h3-7,13H,8-9H2,1-2H3 |
| InChIKey | BXVQKVYWSIMMLN-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 29.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.24 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|