C19H18BrClF3N3O — CID 162374967
(2S)-2-[[2-(4-bromo-2,3,6-trifluorophenyl)-7-methylimidazo[1,2-a]pyridin-3-yl]methyl]morpholine;hydrochloride (PubChem CID 162374967) has the molecular formula C19H18BrClF3N3O and a molecular weight of 476.72 g/mol. Its IUPAC name is (2S)-2-[[2-(4-bromo-2,3,6-trifluorophenyl)-7-methylimidazo[1,2-a]pyridin-3-yl]methyl]morpholine;hydrochloride.
| Compound Name | (2S)-2-[[2-(4-bromo-2,3,6-trifluorophenyl)-7-methylimidazo[1,2-a]pyridin-3-yl]methyl]morpholine;hydrochloride |
|---|---|
| PubChem CID | 162374967 |
| Molecular Formula | C19H18BrClF3N3O |
| Molecular Weight | 476.72 g/mol |
| Exact Mass | 475.03 |
| IUPAC Name | (2S)-2-[[2-(4-bromo-2,3,6-trifluorophenyl)-7-methylimidazo[1,2-a]pyridin-3-yl]methyl]morpholine;hydrochloride |
| SMILES | Cc1ccn2c(C[C@H]3CNCCO3)c(-c3c(F)cc(Br)c(F)c3F)nc2c1.Cl |
| InChI | InChI=1S/C19H17BrF3N3O.ClH/c1-10-2-4-26-14(7-11-9-24-3-5-27-11)19(25-15(26)6-10)16-13(21)8-12(20)17(22)18(16)23;/h2,4,6,8,11,24H,3,5,7,9H2,1H3;1H/t11-;/m0./s1 |
| InChIKey | ANOLBJOAQGDETJ-MERQFXBCSA-N |
| XLogP | 4.44 |
| TPSA | 38.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.72 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|