C19H18BrClFN3O — CID 154965270
2-[[2-(4-bromo-2-chloro-5-fluorophenyl)-7-methylimidazo[1,2-a]pyridin-3-yl]methyl]morpholine (PubChem CID 154965270) has the molecular formula C19H18BrClFN3O and a molecular weight of 438.73 g/mol. Its IUPAC name is 2-[[2-(4-bromo-2-chloro-5-fluorophenyl)-7-methylimidazo[1,2-a]pyridin-3-yl]methyl]morpholine.
| Compound Name | 2-[[2-(4-bromo-2-chloro-5-fluorophenyl)-7-methylimidazo[1,2-a]pyridin-3-yl]methyl]morpholine |
|---|---|
| PubChem CID | 154965270 |
| Molecular Formula | C19H18BrClFN3O |
| Molecular Weight | 438.73 g/mol |
| Exact Mass | 437.03 |
| IUPAC Name | 2-[[2-(4-bromo-2-chloro-5-fluorophenyl)-7-methylimidazo[1,2-a]pyridin-3-yl]methyl]morpholine |
| SMILES | Cc1ccn2c(CC3CNCCO3)c(-c3cc(F)c(Br)cc3Cl)nc2c1 |
| InChI | InChI=1S/C19H18BrClFN3O/c1-11-2-4-25-17(7-12-10-23-3-5-26-12)19(24-18(25)6-11)13-8-16(22)14(20)9-15(13)21/h2,4,6,8-9,12,23H,3,5,7,10H2,1H3 |
| InChIKey | WWOOWQKBZCVJQW-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 38.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.73 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|