C12H22F2N2O3 — CID 113303947
4-[2-(2,2-difluoroethylcarbamoylamino)ethyl]heptanoic acid (PubChem CID 113303947) has the molecular formula C12H22F2N2O3 and a molecular weight of 280.31 g/mol. Its IUPAC name is 4-[2-(2,2-difluoroethylcarbamoylamino)ethyl]heptanoic acid.
| Compound Name | 4-[2-(2,2-difluoroethylcarbamoylamino)ethyl]heptanoic acid |
|---|---|
| PubChem CID | 113303947 |
| Molecular Formula | C12H22F2N2O3 |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 4-[2-(2,2-difluoroethylcarbamoylamino)ethyl]heptanoic acid |
| SMILES | CCCC(CCNC(=O)NCC(F)F)CCC(=O)O |
| InChI | InChI=1S/C12H22F2N2O3/c1-2-3-9(4-5-11(17)18)6-7-15-12(19)16-8-10(13)14/h9-10H,2-8H2,1H3,(H,17,18)(H2,15,16,19) |
| InChIKey | JFQRCAVHOQEUCK-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |