C15H30N2O3 — CID 77033094
4-[2-[(2-amino-3,3-dimethylbutanoyl)amino]ethyl]heptanoic acid (PubChem CID 77033094) has the molecular formula C15H30N2O3 and a molecular weight of 286.42 g/mol. Its IUPAC name is 4-[2-[(2-amino-3,3-dimethylbutanoyl)amino]ethyl]heptanoic acid.
| Compound Name | 4-[2-[(2-amino-3,3-dimethylbutanoyl)amino]ethyl]heptanoic acid |
|---|---|
| PubChem CID | 77033094 |
| Molecular Formula | C15H30N2O3 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | 4-[2-[(2-amino-3,3-dimethylbutanoyl)amino]ethyl]heptanoic acid |
| SMILES | CCCC(CCNC(=O)C(N)C(C)(C)C)CCC(=O)O |
| InChI | InChI=1S/C15H30N2O3/c1-5-6-11(7-8-12(18)19)9-10-17-14(20)13(16)15(2,3)4/h11,13H,5-10,16H2,1-4H3,(H,17,20)(H,18,19) |
| InChIKey | DSXHLTOJEWQXOS-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |