C11H24N2O2 — CID 115751041
2-amino-N-(3-hydroxypentyl)-3,3-dimethylbutanamide (PubChem CID 115751041) has the molecular formula C11H24N2O2 and a molecular weight of 216.32 g/mol. Its IUPAC name is 2-amino-N-(3-hydroxypentyl)-3,3-dimethylbutanamide.
| Compound Name | 2-amino-N-(3-hydroxypentyl)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 115751041 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | 2-amino-N-(3-hydroxypentyl)-3,3-dimethylbutanamide |
| SMILES | CCC(O)CCNC(=O)C(N)C(C)(C)C |
| InChI | InChI=1S/C11H24N2O2/c1-5-8(14)6-7-13-10(15)9(12)11(2,3)4/h8-9,14H,5-7,12H2,1-4H3,(H,13,15) |
| InChIKey | XNTGKWUKGFIZER-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |