C15H24N2O — CID 113305944
3-[[1-(aminomethyl)-4-methyl-3,4-dihydro-2H-naphthalen-1-yl]amino]propan-1-ol (PubChem CID 113305944) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is 3-[[1-(aminomethyl)-4-methyl-3,4-dihydro-2H-naphthalen-1-yl]amino]propan-1-ol.
| Compound Name | 3-[[1-(aminomethyl)-4-methyl-3,4-dihydro-2H-naphthalen-1-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 113305944 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 3-[[1-(aminomethyl)-4-methyl-3,4-dihydro-2H-naphthalen-1-yl]amino]propan-1-ol |
| SMILES | CC1CCC(CN)(NCCCO)c2ccccc21 |
| InChI | InChI=1S/C15H24N2O/c1-12-7-8-15(11-16,17-9-4-10-18)14-6-3-2-5-13(12)14/h2-3,5-6,12,17-18H,4,7-11,16H2,1H3 |
| InChIKey | OFTQCUPNFFSMOQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|