C16H24O — CID 115419566
4-methyl-1-pentyl-3,4-dihydro-2H-naphthalen-1-ol (PubChem CID 115419566) has the molecular formula C16H24O and a molecular weight of 232.37 g/mol. Its IUPAC name is 4-methyl-1-pentyl-3,4-dihydro-2H-naphthalen-1-ol.
| Compound Name | 4-methyl-1-pentyl-3,4-dihydro-2H-naphthalen-1-ol |
|---|---|
| PubChem CID | 115419566 |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | 4-methyl-1-pentyl-3,4-dihydro-2H-naphthalen-1-ol |
| SMILES | CCCCCC1(O)CCC(C)c2ccccc21 |
| InChI | InChI=1S/C16H24O/c1-3-4-7-11-16(17)12-10-13(2)14-8-5-6-9-15(14)16/h5-6,8-9,13,17H,3-4,7,10-12H2,1-2H3 |
| InChIKey | AWWYYZRHQFTZRV-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|