C12H22N2O4S — CID 113309107
1-[(piperidin-1-ylsulfonylamino)methyl]cyclopentane-1-carboxylic acid (PubChem CID 113309107) has the molecular formula C12H22N2O4S and a molecular weight of 290.39 g/mol. Its IUPAC name is 1-[(piperidin-1-ylsulfonylamino)methyl]cyclopentane-1-carboxylic acid.
| Compound Name | 1-[(piperidin-1-ylsulfonylamino)methyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 113309107 |
| Molecular Formula | C12H22N2O4S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 1-[(piperidin-1-ylsulfonylamino)methyl]cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C1(CNS(=O)(=O)N2CCCCC2)CCCC1 |
| InChI | InChI=1S/C12H22N2O4S/c15-11(16)12(6-2-3-7-12)10-13-19(17,18)14-8-4-1-5-9-14/h13H,1-10H2,(H,15,16) |
| InChIKey | TYPFLSFYUYTZKS-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |