C15H27NO4S — CID 115443542
1-[(cyclohexylsulfonylamino)methyl]cycloheptane-1-carboxylic acid (PubChem CID 115443542) has the molecular formula C15H27NO4S and a molecular weight of 317.45 g/mol. Its IUPAC name is 1-[(cyclohexylsulfonylamino)methyl]cycloheptane-1-carboxylic acid.
| Compound Name | 1-[(cyclohexylsulfonylamino)methyl]cycloheptane-1-carboxylic acid |
|---|---|
| PubChem CID | 115443542 |
| Molecular Formula | C15H27NO4S |
| Molecular Weight | 317.45 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 1-[(cyclohexylsulfonylamino)methyl]cycloheptane-1-carboxylic acid |
| SMILES | O=C(O)C1(CNS(=O)(=O)C2CCCCC2)CCCCCC1 |
| InChI | InChI=1S/C15H27NO4S/c17-14(18)15(10-6-1-2-7-11-15)12-16-21(19,20)13-8-4-3-5-9-13/h13,16H,1-12H2,(H,17,18) |
| InChIKey | IJGCVRBUXYURKN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.45 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |