C12H13IN2O4 — CID 113311123
1-[(4-iodo-2-nitroanilino)methyl]cyclobutane-1-carboxylic acid (PubChem CID 113311123) has the molecular formula C12H13IN2O4 and a molecular weight of 376.15 g/mol. Its IUPAC name is 1-[(4-iodo-2-nitroanilino)methyl]cyclobutane-1-carboxylic acid.
| Compound Name | 1-[(4-iodo-2-nitroanilino)methyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 113311123 |
| Molecular Formula | C12H13IN2O4 |
| Molecular Weight | 376.15 g/mol |
| Exact Mass | 375.99 |
| IUPAC Name | 1-[(4-iodo-2-nitroanilino)methyl]cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1(CNc2ccc(I)cc2[N+](=O)[O-])CCC1 |
| InChI | InChI=1S/C12H13IN2O4/c13-8-2-3-9(10(6-8)15(18)19)14-7-12(11(16)17)4-1-5-12/h2-3,6,14H,1,4-5,7H2,(H,16,17) |
| InChIKey | ULADKFGCGOEIQN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.15 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|