C14H17IN2O4 — CID 115436134
1-[(4-iodo-2-nitroanilino)methyl]cyclohexane-1-carboxylic acid (PubChem CID 115436134) has the molecular formula C14H17IN2O4 and a molecular weight of 404.20 g/mol. Its IUPAC name is 1-[(4-iodo-2-nitroanilino)methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[(4-iodo-2-nitroanilino)methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 115436134 |
| Molecular Formula | C14H17IN2O4 |
| Molecular Weight | 404.20 g/mol |
| Exact Mass | 404.02 |
| IUPAC Name | 1-[(4-iodo-2-nitroanilino)methyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1(CNc2ccc(I)cc2[N+](=O)[O-])CCCCC1 |
| InChI | InChI=1S/C14H17IN2O4/c15-10-4-5-11(12(8-10)17(20)21)16-9-14(13(18)19)6-2-1-3-7-14/h4-5,8,16H,1-3,6-7,9H2,(H,18,19) |
| InChIKey | BJNNYLZDHZMIIK-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.20 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|