C44H48N2O3 — CID 11331239
2,6-bis[[(2R)-2-[hydroxy(diphenyl)methyl]pyrrolidin-1-yl]methyl]-3,5-dimethylphenol (PubChem CID 11331239) has the molecular formula C44H48N2O3 and a molecular weight of 652.88 g/mol. Its IUPAC name is 2,6-bis[[(2R)-2-[hydroxy(diphenyl)methyl]pyrrolidin-1-yl]methyl]-3,5-dimethylphenol.
| Compound Name | 2,6-bis[[(2R)-2-[hydroxy(diphenyl)methyl]pyrrolidin-1-yl]methyl]-3,5-dimethylphenol |
|---|---|
| PubChem CID | 11331239 |
| Molecular Formula | C44H48N2O3 |
| Molecular Weight | 652.88 g/mol |
| Exact Mass | 652.37 |
| IUPAC Name | 2,6-bis[[(2R)-2-[hydroxy(diphenyl)methyl]pyrrolidin-1-yl]methyl]-3,5-dimethylphenol |
| SMILES | Cc1cc(C)c(CN2CCC[C@@H]2C(O)(c2ccccc2)c2ccccc2)c(O)c1CN1CCC[C@@H]1C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C44H48N2O3/c1-32-29-33(2)39(31-46-28-16-26-41(46)44(49,36-21-11-5-12-22-36)37-23-13-6-14-24-37)42(47)38(32)30-45-27-15-25-40(45)43(48,34-17-7-3-8-18-34)35-19-9-4-10-20-35/h3-14,17-24,29,40-41,47-49H,15-16,25-28,30-31H2,1-2H3/t40-,41-/m1/s1 |
| InChIKey | UFPIMDJVKIMSMJ-GYOJGHLZSA-N |
| XLogP | 7.81 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.88 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|