C48H39F6NO3 — CID 155921221
2-[[(2S)-2-[hydroxy-bis[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-1-yl]methyl]-6-[hydroxy(dinaphthalen-1-yl)methyl]-4-methylphenol (PubChem CID 155921221) has the molecular formula C48H39F6NO3 and a molecular weight of 791.83 g/mol. Its IUPAC name is 2-[[(2S)-2-[hydroxy-bis[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-1-yl]methyl]-6-[hydroxy(dinaphthalen-1-yl)methyl]-4-methylphenol.
| Compound Name | 2-[[(2S)-2-[hydroxy-bis[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-1-yl]methyl]-6-[hydroxy(dinaphthalen-1-yl)methyl]-4-methylphenol |
|---|---|
| PubChem CID | 155921221 |
| Molecular Formula | C48H39F6NO3 |
| Molecular Weight | 791.83 g/mol |
| Exact Mass | 791.28 |
| IUPAC Name | 2-[[(2S)-2-[hydroxy-bis[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-1-yl]methyl]-6-[hydroxy(dinaphthalen-1-yl)methyl]-4-methylphenol |
| SMILES | Cc1cc(CN2CCC[C@H]2C(O)(c2ccc(C(F)(F)F)cc2)c2ccc(C(F)(F)F)cc2)c(O)c(C(O)(c2cccc3ccccc23)c2cccc3ccccc23)c1 |
| InChI | InChI=1S/C48H39F6NO3/c1-30-27-33(29-55-26-8-17-43(55)45(57,34-18-22-36(23-19-34)47(49,50)51)35-20-24-37(25-21-35)48(52,53)54)44(56)42(28-30)46(58,40-15-6-11-31-9-2-4-13-38(31)40)41-16-7-12-32-10-3-5-14-39(32)41/h2-7,9-16,18-25,27-28,43,56-58H,8,17,26,29H2,1H3/t43-/m0/s1 |
| InChIKey | VBYAUESIPCHKFE-QLKFWGTOSA-N |
| XLogP | 11.23 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.83 |
| LogP ≤ 5 | 11.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|