C42H39F6NO5 — CID 155818718
2-[[(2S)-2-[hydroxy-bis(4-methoxyphenyl)methyl]pyrrolidin-1-yl]methyl]-6-[hydroxy-bis[4-(trifluoromethyl)phenyl]methyl]-4-methylphenol (PubChem CID 155818718) has the molecular formula C42H39F6NO5 and a molecular weight of 751.76 g/mol. Its IUPAC name is 2-[[(2S)-2-[hydroxy-bis(4-methoxyphenyl)methyl]pyrrolidin-1-yl]methyl]-6-[hydroxy-bis[4-(trifluoromethyl)phenyl]methyl]-4-methylphenol.
| Compound Name | 2-[[(2S)-2-[hydroxy-bis(4-methoxyphenyl)methyl]pyrrolidin-1-yl]methyl]-6-[hydroxy-bis[4-(trifluoromethyl)phenyl]methyl]-4-methylphenol |
|---|---|
| PubChem CID | 155818718 |
| Molecular Formula | C42H39F6NO5 |
| Molecular Weight | 751.76 g/mol |
| Exact Mass | 751.27 |
| IUPAC Name | 2-[[(2S)-2-[hydroxy-bis(4-methoxyphenyl)methyl]pyrrolidin-1-yl]methyl]-6-[hydroxy-bis[4-(trifluoromethyl)phenyl]methyl]-4-methylphenol |
| SMILES | COc1ccc(C(O)(c2ccc(OC)cc2)[C@@H]2CCCN2Cc2cc(C)cc(C(O)(c3ccc(C(F)(F)F)cc3)c3ccc(C(F)(F)F)cc3)c2O)cc1 |
| InChI | InChI=1S/C42H39F6NO5/c1-26-23-27(25-49-22-4-5-37(49)40(52,30-14-18-34(53-2)19-15-30)31-16-20-35(54-3)21-17-31)38(50)36(24-26)39(51,28-6-10-32(11-7-28)41(43,44)45)29-8-12-33(13-9-29)42(46,47)48/h6-21,23-24,37,50-52H,4-5,22,25H2,1-3H3/t37-/m0/s1 |
| InChIKey | RCDWPTOELUNTMD-QNGWXLTQSA-N |
| XLogP | 8.94 |
| TPSA | 82.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.76 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|