2-[2-[(4,4-dimethylpiperidin-1-yl)methyl]phenyl]acetic acid

C16H23NO2 — CID 113314657

IUPAC2-[2-[(4,4-dimethylpiperidin-1-yl)methyl]phenyl]acetic acid
SMILESCC1(C)CCN(Cc2ccccc2CC(=O)O)CC1
InChIInChI=1S/C16H23NO2/c1-16(2)7-9-17(10-8-16)12-14-6-4-3-5-13(14)11-15(18)19/h3-6H,7-12H2,1-2H3,(H,18,19)
InChIKeyCZVQPWNPSWGDCP-UHFFFAOYSA-N
MW261.37 g/mol
LogP2.94
Rot. Bonds4

About 2-[2-[(4,4-dimethylpiperidin-1-yl)methyl]phenyl]acetic acid

2-[2-[(4,4-dimethylpiperidin-1-yl)methyl]phenyl]acetic acid (PubChem CID 113314657) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is 2-[2-[(4,4-dimethylpiperidin-1-yl)methyl]phenyl]acetic acid.

Molecular Properties

Compound Name2-[2-[(4,4-dimethylpiperidin-1-yl)methyl]phenyl]acetic acid
PubChem CID113314657
Molecular FormulaC16H23NO2
Molecular Weight261.37 g/mol
Exact Mass261.17
IUPAC Name2-[2-[(4,4-dimethylpiperidin-1-yl)methyl]phenyl]acetic acid
SMILESCC1(C)CCN(Cc2ccccc2CC(=O)O)CC1
InChIInChI=1S/C16H23NO2/c1-16(2)7-9-17(10-8-16)12-14-6-4-3-5-13(14)11-15(18)19/h3-6H,7-12H2,1-2H3,(H,18,19)
InChIKeyCZVQPWNPSWGDCP-UHFFFAOYSA-N
XLogP2.94
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500261.37
LogP ≤ 52.94
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-[2-[(4,4-dimethylpiperidin-1-yl)methyl]phenyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-[(4,4-dimethylpiperidin-1-yl)methyl]phenyl]acetic acid?
The IUPAC name of 2-[2-[(4,4-dimethylpiperidin-1-yl)methyl]phenyl]acetic acid (CID 113314657) is 2-[2-[(4,4-dimethylpiperidin-1-yl)methyl]phenyl]acetic acid.
What is the SMILES notation for 2-[2-[(4,4-dimethylpiperidin-1-yl)methyl]phenyl]acetic acid?
The canonical SMILES for 2-[2-[(4,4-dimethylpiperidin-1-yl)methyl]phenyl]acetic acid is CC1(C)CCN(Cc2ccccc2CC(=O)O)CC1.
What is the InChIKey of 2-[2-[(4,4-dimethylpiperidin-1-yl)methyl]phenyl]acetic acid?
The InChIKey is CZVQPWNPSWGDCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO2/c1-16(2)7-9-17(10-8-16)12-14-6-4-3-5-13(14)11-15(18)19/h3-6H,7-12H2,1-2H3,(H,18,19).
What are the key properties of 2-[2-[(4,4-dimethylpiperidin-1-yl)methyl]phenyl]acetic acid?
2-[2-[(4,4-dimethylpiperidin-1-yl)methyl]phenyl]acetic acid has a molecular weight of 261.37 g/mol, XLogP of 2.94, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(4,4-dimethylpiperidin-1-yl)methyl]phenyl]acetic acid is sourced from PubChem (CID 113314657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).