C10H10ClN5O — CID 113317014
1-(3-amino-6-chloro-2-pyridinyl)-N-methylpyrazole-3-carboxamide (PubChem CID 113317014) has the molecular formula C10H10ClN5O and a molecular weight of 251.68 g/mol. Its IUPAC name is 1-(3-amino-6-chloro-2-pyridinyl)-N-methylpyrazole-3-carboxamide.
| Compound Name | 1-(3-amino-6-chloro-2-pyridinyl)-N-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 113317014 |
| Molecular Formula | C10H10ClN5O |
| Molecular Weight | 251.68 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | 1-(3-amino-6-chloro-2-pyridinyl)-N-methylpyrazole-3-carboxamide |
| SMILES | CNC(=O)c1ccn(-c2nc(Cl)ccc2N)n1 |
| InChI | InChI=1S/C10H10ClN5O/c1-13-10(17)7-4-5-16(15-7)9-6(12)2-3-8(11)14-9/h2-5H,12H2,1H3,(H,13,17) |
| InChIKey | VQRJPDWQHMWVTN-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.68 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|