C11H8ClN5O — CID 83076446
1-(6-chloro-4-cyano-2-pyridinyl)-N-methylpyrazole-3-carboxamide (PubChem CID 83076446) has the molecular formula C11H8ClN5O and a molecular weight of 261.67 g/mol. Its IUPAC name is 1-(6-chloro-4-cyano-2-pyridinyl)-N-methylpyrazole-3-carboxamide.
| Compound Name | 1-(6-chloro-4-cyano-2-pyridinyl)-N-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 83076446 |
| Molecular Formula | C11H8ClN5O |
| Molecular Weight | 261.67 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | 1-(6-chloro-4-cyano-2-pyridinyl)-N-methylpyrazole-3-carboxamide |
| SMILES | CNC(=O)c1ccn(-c2cc(C#N)cc(Cl)n2)n1 |
| InChI | InChI=1S/C11H8ClN5O/c1-14-11(18)8-2-3-17(16-8)10-5-7(6-13)4-9(12)15-10/h2-5H,1H3,(H,14,18) |
| InChIKey | ZYQPRVVBHKNDKC-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.67 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|